Products 2225-05-0
CAS 2225-05-0 appears in our catalog under these names: 4,4'-((Ethane-1,2-diylbis(oxy))bis(carbonyl))dibenzoic acid 98%, 1,4-Benzenedicarboxylic acid, 1,2-ethanediyl ester, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[2-(4-carboxybenzoyl)oxyethoxycarbonyl]benzoic acid (CAS 2225-05-0) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: 4-[2-(4-carboxybenzoyl)oxyethoxycarbonyl]benzoic acid. InChIKey: WFBOYZZQPYDMKX-UHFFFAOYSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 4-[2-(4-carboxybenzoyl)oxyethoxycarbonyl]benzoic acid |
| InChIKey | WFBOYZZQPYDMKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)C(=O)OCCOC(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
ethylene terephthalate, Terephthalic acid, ethylene ester, 1,4-Benzenedicarboxylic acid, 1,1'-(1,2-ethanediyl) ester, 4,4'-((ethane-1,2-diylbis(oxy))bis(carbonyl))dibenzoic acid, 1,2-bis-(4-carboxy-benzoyloxy)-ethane, 4,4'-(1,2-Ethanediylbis(oxycarbonyl))dibenzoic acid, 4-[2-(4-carboxybenzoyl)oxyethoxycarbonyl]benzoic acid, starbld0036440