Products 578-19-8
CAS 578-19-8 appears in our catalog under these names: 2,2'-(Succinylbis(oxy))dibenzoic acid 97%, 2,2'-(Succinylbis(oxy))dibenzoic acid, 97%, 97%, Bis(2-carboxyphenyl) succinate, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg.
2-[4-(2-carboxyphenoxy)-4-oxobutanoyl]oxybenzoic acid (CAS 578-19-8) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: 2-[4-(2-carboxyphenoxy)-4-oxobutanoyl]oxybenzoic acid. InChIKey: PREOBXYMXLETCA-UHFFFAOYSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 2-[4-(2-carboxyphenoxy)-4-oxobutanoyl]oxybenzoic acid |
| InChIKey | PREOBXYMXLETCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OC(=O)CCC(=O)OC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Succinyldisalicylic acid, Diaspirin, Bis(o-carboxyphenyl)succinate, Succinylsalicylic acid, Bis(2-carboxyphenyl) succinate, 2,2'-(Succinylbis(oxy))dibenzoic acid, Salisuccyl, 2-[4-(2-carboxyphenoxy)-4-oxobutanoyl]oxybenzoic acid, Bis(o-carboxyphenyl) succinate, O,O-Succinyldi(salicylic acid)