CAS 111955-48-7 appears in our catalog under these names: Rotigotine Impurity 13, Ramipril Impurity 17. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R,3S)-2,3-dibenzoyloxybutanedioic acid (CAS 111955-48-7) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: (2R,3S)-2,3-dibenzoyloxybutanedioic acid. InChIKey: YONLFQNRGZXBBF-OKILXGFUSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | (2R,3S)-2,3-dibenzoyloxybutanedioic acid |
| InChIKey | YONLFQNRGZXBBF-OKILXGFUSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)O[C@H]([C@@H](C(=O)O)OC(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)