Products 118159-47-0
CAS 118159-47-0 is the registry number for Bicyclol Impurity A. Offered by: Chemat Brand. Available pack sizes: on request.
8,16-dimethoxy-4,6,12,18,20-pentaoxapentacyclo[12.7.0.02,10.03,7.017,21]henicosa-1(21),2,7,9,14,16-hexaen-11-one (CAS 118159-47-0) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: 8,16-dimethoxy-4,6,12,18,20-pentaoxapentacyclo[12.7.0.02,10.03,7.017,21]henicosa-1(21),2,7,9,14,16-hexaen-11-one. InChIKey: GNENCUYZSDXGIW-UHFFFAOYSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 8,16-dimethoxy-4,6,12,18,20-pentaoxapentacyclo[12.7.0.02,10.03,7.017,21]henicosa-1(21),2,7,9,14,16-hexaen-11-one |
| InChIKey | GNENCUYZSDXGIW-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C3C(=C1)COC(=O)C4=CC(=C5C(=C43)OCO5)OC)OCO2 |
Computed by PubChem (NCBI)
Synonyms:
Bicyclol Impurity A