Products 141186-15-4
CAS 141186-15-4 is the registry number for Bis(4-formyl-2-methoxyphenyl) oxalate. Offered by: Biosynth. Available pack sizes: 2g.
Bis(4-formyl-2-methoxyphenyl) oxalate (CAS 141186-15-4) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: bis(4-formyl-2-methoxyphenyl) oxalate. InChIKey: SHJFTNXRNIIYGW-UHFFFAOYSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | bis(4-formyl-2-methoxyphenyl) oxalate |
| InChIKey | SHJFTNXRNIIYGW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OC(=O)C(=O)OC2=C(C=C(C=C2)C=O)OC |
Computed by PubChem (NCBI)