Products 1774401-34-1
CAS 1774401-34-1 appears in our catalog under these names: 5,5'–(Ethane–1,2–diyl)diisophthalic acid, 5,5'-(Ethane-1,2-diyl)diisophthalic acid, 98%, 98%, 5,5'-(Ethane-1,2-diyl)diisophthalic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 500mg, 100mg, 250mg.
5-[2-(3,5-dicarboxyphenyl)ethyl]benzene-1,3-dicarboxylic acid (CAS 1774401-34-1) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: 5-[2-(3,5-dicarboxyphenyl)ethyl]benzene-1,3-dicarboxylic acid. InChIKey: OPVGPUMQLUVBQF-UHFFFAOYSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 5-[2-(3,5-dicarboxyphenyl)ethyl]benzene-1,3-dicarboxylic acid |
| InChIKey | OPVGPUMQLUVBQF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)CCC2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)