CAS 106589-22-4 is the registry number for 3-Cyano-2-iodobenzoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
3-cyano-2-iodobenzoic acid (CAS 106589-22-4) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 3-cyano-2-iodobenzoic acid. InChIKey: LYQYOMPRHIJZGV-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 3-cyano-2-iodobenzoic acid |
| InChIKey | LYQYOMPRHIJZGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)O)I)C#N |
Computed by PubChem (NCBI)