Products 106820-14-8
CAS 106820-14-8 is the registry number for (3R,4S,5R)-2-Hydroxytetrahydro-2H-pyran-3,4,5-triyl triacetate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[(3R,4S,5R)-4,5-diacetyloxy-6-hydroxyoxan-3-yl] acetate (CAS 106820-14-8) is a chemical compound with the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. IUPAC name: [(3R,4S,5R)-4,5-diacetyloxy-6-hydroxyoxan-3-yl] acetate. InChIKey: NHLHTUYICZOCMA-GZBOUJLJSA-N.
| Molecular formula | C11H16O8 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | [(3R,4S,5R)-4,5-diacetyloxy-6-hydroxyoxan-3-yl] acetate |
| InChIKey | NHLHTUYICZOCMA-GZBOUJLJSA-N |
| SMILES | CC(=O)O[C@@H]1COC([C@@H]([C@H]1OC(=O)C)OC(=O)C)O |
Computed by PubChem (NCBI)