CAS 65024-85-3 appears in our catalog under these names: Azacitidine Impurity 31, 2,3,5-Triacetyl beta-D-Ribofuranose. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-hydroxyoxolan-2-yl]methyl acetate (CAS 65024-85-3) is a chemical compound with the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4-diacetyloxy-5-hydroxyoxolan-2-yl]methyl acetate. InChIKey: RCDVSNGCFMKYLB-GWOFURMSSA-N.
| Molecular formula | C11H16O8 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-hydroxyoxolan-2-yl]methyl acetate |
| InChIKey | RCDVSNGCFMKYLB-GWOFURMSSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)O)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)