CAS 130792-81-3 is the registry number for Ribavirin Impurity 54. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4R,5S)-4,5-diacetyloxy-2-(hydroxymethyl)oxolan-3-yl] acetate (CAS 130792-81-3) is a chemical compound with the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. IUPAC name: [(2R,3R,4R,5S)-4,5-diacetyloxy-2-(hydroxymethyl)oxolan-3-yl] acetate. InChIKey: BGAWRLZKVIFLKK-GWOFURMSSA-N.
| Molecular formula | C11H16O8 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | [(2R,3R,4R,5S)-4,5-diacetyloxy-2-(hydroxymethyl)oxolan-3-yl] acetate |
| InChIKey | BGAWRLZKVIFLKK-GWOFURMSSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](O[C@H]([C@@H]1OC(=O)C)OC(=O)C)CO |
Computed by PubChem (NCBI)