CAS 855898-43-0 appears in our catalog under these names: Heptane-1,1,7,7-Tetracarboxilic Acid, 1,1,7,7-Heptanetetracarboxylic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
Heptane-1,1,7,7-tetracarboxylic acid (CAS 855898-43-0) is a chemical compound with the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. IUPAC name: heptane-1,1,7,7-tetracarboxylic acid. InChIKey: DNUVPRGWMXVTII-UHFFFAOYSA-N.
| Molecular formula | C11H16O8 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | heptane-1,1,7,7-tetracarboxylic acid |
| InChIKey | DNUVPRGWMXVTII-UHFFFAOYSA-N |
| SMILES | C(CCC(C(=O)O)C(=O)O)CCC(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)