CAS 1696397-15-5 appears in our catalog under these names: Pregabalin Impurity 57, Pregabalin Impurity 117, 2-Isobutylpropane-1,1,3,3-tetracarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-methylpropyl)propane-1,1,3,3-tetracarboxylic acid (CAS 1696397-15-5) is a chemical compound with the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. IUPAC name: 2-(2-methylpropyl)propane-1,1,3,3-tetracarboxylic acid. InChIKey: RMEIIVVTCGPCHM-UHFFFAOYSA-N.
| Molecular formula | C11H16O8 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | 2-(2-methylpropyl)propane-1,1,3,3-tetracarboxylic acid |
| InChIKey | RMEIIVVTCGPCHM-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(C(=O)O)C(=O)O)C(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)