Products 34296-99-6

CAS 34296-99-6 is the registry number for 3,4-Di-O-acetyl-D-glucuronal methyl ester. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 100mg, 50mg.

Structural formula: {0} (CAS {1})

[(2S,3R,4R,5R)-4-acetyloxy-2,5-dihydroxy-1,6-dioxoheptan-3-yl] acetate (CAS 34296-99-6) is a chemical compound with the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. IUPAC name: [(2S,3R,4R,5R)-4-acetyloxy-2,5-dihydroxy-1,6-dioxoheptan-3-yl] acetate. InChIKey: YZGCKUDUZYWDTL-LMLFDSFASA-N.

Identity
Molecular formulaC11H16O8
Molecular weight276.24 g/mol
IUPAC name[(2S,3R,4R,5R)-4-acetyloxy-2,5-dihydroxy-1,6-dioxoheptan-3-yl] acetate
InChIKeyYZGCKUDUZYWDTL-LMLFDSFASA-N
SMILESCC(=O)[C@@H]([C@H]([C@@H]([C@@H](C=O)O)OC(=O)C)OC(=O)C)O

Computed by PubChem (NCBI)