CAS 34296-99-6 is the registry number for 3,4-Di-O-acetyl-D-glucuronal methyl ester. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 100mg, 50mg.
[(2S,3R,4R,5R)-4-acetyloxy-2,5-dihydroxy-1,6-dioxoheptan-3-yl] acetate (CAS 34296-99-6) is a chemical compound with the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. IUPAC name: [(2S,3R,4R,5R)-4-acetyloxy-2,5-dihydroxy-1,6-dioxoheptan-3-yl] acetate. InChIKey: YZGCKUDUZYWDTL-LMLFDSFASA-N.
| Molecular formula | C11H16O8 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | [(2S,3R,4R,5R)-4-acetyloxy-2,5-dihydroxy-1,6-dioxoheptan-3-yl] acetate |
| InChIKey | YZGCKUDUZYWDTL-LMLFDSFASA-N |
| SMILES | CC(=O)[C@@H]([C@H]([C@@H]([C@@H](C=O)O)OC(=O)C)OC(=O)C)O |
Computed by PubChem (NCBI)