CAS 55018-54-7 appears in our catalog under these names: (2R,3S,4R)-1-Hydroxy-5-oxopentane-2,3,4-triyl triacetate, 97%, 2,3,4-Tri-O-acetyl-D-xylopyranose. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 250mg, 50mg, 1000mg, 500mg.
[(3R,4S,5R)-4,5-diacetyloxy-6-hydroxyoxan-3-yl] acetate (CAS 55018-54-7) is a chemical compound with the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. IUPAC name: [(3R,4S,5R)-4,5-diacetyloxy-6-hydroxyoxan-3-yl] acetate. InChIKey: NHLHTUYICZOCMA-GZBOUJLJSA-N.
| Molecular formula | C11H16O8 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | [(3R,4S,5R)-4,5-diacetyloxy-6-hydroxyoxan-3-yl] acetate |
| InChIKey | NHLHTUYICZOCMA-GZBOUJLJSA-N |
| SMILES | CC(=O)O[C@@H]1COC([C@@H]([C@H]1OC(=O)C)OC(=O)C)O |
Computed by PubChem (NCBI)