CAS 1567042-39-0 is the registry number for (2-(4-Methylthiazol-2-yl)-1H-imidazol-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(4-methyl-1,3-thiazol-2-yl)-1H-imidazol-5-yl]methanol (CAS 1567042-39-0) is a chemical compound with the molecular formula C8H9N3OS and a molecular weight of 195.24 g/mol. IUPAC name: [2-(4-methyl-1,3-thiazol-2-yl)-1H-imidazol-5-yl]methanol. InChIKey: FOXLIXLALGXQSA-UHFFFAOYSA-N.
| Molecular formula | C8H9N3OS |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | [2-(4-methyl-1,3-thiazol-2-yl)-1H-imidazol-5-yl]methanol |
| InChIKey | FOXLIXLALGXQSA-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C2=NC=C(N2)CO |
Computed by PubChem (NCBI)