Products 1072945-77-7
CAS 1072945-77-7 appears in our catalog under these names: 2–Chloro–6–fluoro–3–methoxyphenylboronic acid, 2-Chloro-6-fluoro-3-methoxyphenylboronic acid, 97%, 97%, 2-Chloro-6-fluoro-3-methoxyphenyl boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100mg, 250mg, 1g.
(2-chloro-6-fluoro-3-methoxyphenyl)boronic acid (CAS 1072945-77-7) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (2-chloro-6-fluoro-3-methoxyphenyl)boronic acid. InChIKey: DBGNLKDIFHCCCT-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (2-chloro-6-fluoro-3-methoxyphenyl)boronic acid |
| InChIKey | DBGNLKDIFHCCCT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)OC)F)(O)O |
Computed by PubChem (NCBI)