CAS 33643-47-9 is the registry number for (S)-(+)-Ketamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 2g, 5g.
(2S)-2-(2-chlorophenyl)-2-(methylamino)cyclohexan-1-one;hydrochloride (CAS 33643-47-9) is a chemical compound with the molecular formula C13H17Cl2NO and a molecular weight of 274.18 g/mol. IUPAC name: (2S)-2-(2-chlorophenyl)-2-(methylamino)cyclohexan-1-one;hydrochloride. InChIKey: VCMGMSHEPQENPE-ZOWNYOTGSA-N.
| Molecular formula | C13H17Cl2NO |
|---|---|
| Molecular weight | 274.18 g/mol |
| IUPAC name | (2S)-2-(2-chlorophenyl)-2-(methylamino)cyclohexan-1-one;hydrochloride |
| InChIKey | VCMGMSHEPQENPE-ZOWNYOTGSA-N |
| SMILES | CN[C@@]1(CCCCC1=O)C2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)