CAS 107410-07-1 appears in our catalog under these names: 4-Methoxybiphenyl-3-carboxylic Acid, >95% (HPLC), 2–Methoxy–5–phenyl–benzoic acid, 2-Methoxy-5-phenyl-benzoic acid 98%, 2-Methoxy-5-phenyl-benzoic acid, 98%, 98%, 4-Methoxy-[1,1'-biphenyl]-3-carboxylic acid, 97%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10mg, 50mg, 250mg, 1g, 5g.
2-methoxy-5-phenylbenzoic acid (CAS 107410-07-1) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 2-methoxy-5-phenylbenzoic acid. InChIKey: NRUOSOAWSBPNPB-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 2-methoxy-5-phenylbenzoic acid |
| InChIKey | NRUOSOAWSBPNPB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)