Products 107524-27-6

CAS 107524-27-6 is the registry number for (2E)-3-[4-(Heptyloxy)-3-methoxyphenyl]acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

(E)-3-(4-heptoxy-3-methoxyphenyl)prop-2-enoic acid (CAS 107524-27-6) is a chemical compound with the molecular formula C17H24O4 and a molecular weight of 292.4 g/mol. IUPAC name: (E)-3-(4-heptoxy-3-methoxyphenyl)prop-2-enoic acid. InChIKey: XDGUJINJMPKTPO-PKNBQFBNSA-N.

Identity
Molecular formulaC17H24O4
Molecular weight292.4 g/mol
IUPAC name(E)-3-(4-heptoxy-3-methoxyphenyl)prop-2-enoic acid
InChIKeyXDGUJINJMPKTPO-PKNBQFBNSA-N
SMILESCCCCCCCOC1=C(C=C(C=C1)/C=C/C(=O)O)OC

Computed by PubChem (NCBI)