Products 2665088-78-6

CAS 2665088-78-6 is the registry number for 3-(3,5-Di-tert-butyl-2-hydroxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3,5-ditert-butyl-2-hydroxyphenyl)-2-oxopropanoic acid (CAS 2665088-78-6) is a chemical compound with the molecular formula C17H24O4 and a molecular weight of 292.4 g/mol. IUPAC name: 3-(3,5-ditert-butyl-2-hydroxyphenyl)-2-oxopropanoic acid. InChIKey: LWHPQUGUMWJYAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24O4
Molecular weight292.4 g/mol
IUPAC name3-(3,5-ditert-butyl-2-hydroxyphenyl)-2-oxopropanoic acid
InChIKeyLWHPQUGUMWJYAZ-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)O)CC(=O)C(=O)O

Computed by PubChem (NCBI)