Products 203251-22-3

CAS 203251-22-3 is the registry number for 2-(2-Ethylhexyloxy)-5-methoxybenzene-1,4-dicarboxaldehyde, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2-(2-ethylhexoxy)-5-methoxyterephthalaldehyde (CAS 203251-22-3) is a chemical compound with the molecular formula C17H24O4 and a molecular weight of 292.4 g/mol. IUPAC name: 2-(2-ethylhexoxy)-5-methoxyterephthalaldehyde. InChIKey: UORXCQDFXKKDOV-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24O4
Molecular weight292.4 g/mol
IUPAC name2-(2-ethylhexoxy)-5-methoxyterephthalaldehyde
InChIKeyUORXCQDFXKKDOV-UHFFFAOYSA-N
SMILESCCCCC(CC)COC1=CC(=C(C=C1C=O)OC)C=O

Computed by PubChem (NCBI)