Products 91485-83-5

CAS 91485-83-5 is the registry number for Methyl Octyl Phthalate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-methyl 2-O-octyl benzene-1,2-dicarboxylate (CAS 91485-83-5) is a chemical compound with the molecular formula C17H24O4 and a molecular weight of 292.4 g/mol. IUPAC name: 1-O-methyl 2-O-octyl benzene-1,2-dicarboxylate. InChIKey: SJMMDRTYFFDPBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24O4
Molecular weight292.4 g/mol
IUPAC name1-O-methyl 2-O-octyl benzene-1,2-dicarboxylate
InChIKeySJMMDRTYFFDPBJ-UHFFFAOYSA-N
SMILESCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OC

Computed by PubChem (NCBI)