CAS 63468-13-3 appears in our catalog under these names: 2-Ethylhexyl Methyl Terephthalate, 1-(2-Ethylhexyl) 4-methyl benzene-1,4-dicarboxylate, 2-Ethylhexyl methyl terephthalate, 97%, 97%, 2-Ethylhexyl methyl terephthalate, 97%. Offered by: Chemat Brand, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: on request, 2,5g, 250mg, 1g, 5g.
4-O-(2-ethylhexyl) 1-O-methyl benzene-1,4-dicarboxylate (CAS 63468-13-3) is a chemical compound with the molecular formula C17H24O4 and a molecular weight of 292.4 g/mol. IUPAC name: 4-O-(2-ethylhexyl) 1-O-methyl benzene-1,4-dicarboxylate. InChIKey: KHDNBLKBTBOSDJ-UHFFFAOYSA-N.
| Molecular formula | C17H24O4 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 4-O-(2-ethylhexyl) 1-O-methyl benzene-1,4-dicarboxylate |
| InChIKey | KHDNBLKBTBOSDJ-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)