Products 953753-04-3
CAS 953753-04-3 is the registry number for 3-(3,5-Di-tert-butyl-4-hydroxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxopropanoic acid (CAS 953753-04-3) is a chemical compound with the molecular formula C17H24O4 and a molecular weight of 292.4 g/mol. IUPAC name: 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxopropanoic acid. InChIKey: YDRMBNYVACWWBP-UHFFFAOYSA-N.
| Molecular formula | C17H24O4 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxopropanoic acid |
| InChIKey | YDRMBNYVACWWBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CC(=O)C(=O)O |
Computed by PubChem (NCBI)