CAS 56166-83-7 appears in our catalog under these names: 2-Ethylhexyl methyl phthalate, 95%, 2-Ethylhexyl Methyl Phthalate, 2-Ethylhexyl methyl phthalate, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, on request.
2-O-(2-ethylhexyl) 1-O-methyl benzene-1,2-dicarboxylate (CAS 56166-83-7) is a chemical compound with the molecular formula C17H24O4 and a molecular weight of 292.4 g/mol. IUPAC name: 2-O-(2-ethylhexyl) 1-O-methyl benzene-1,2-dicarboxylate. InChIKey: MQYNKBGLFNKJPL-UHFFFAOYSA-N.
| Molecular formula | C17H24O4 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 2-O-(2-ethylhexyl) 1-O-methyl benzene-1,2-dicarboxylate |
| InChIKey | MQYNKBGLFNKJPL-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OC |
Computed by PubChem (NCBI)