Products 1075753-24-0
CAS 1075753-24-0 is the registry number for 5-(Methylsulfonyl)-1,3-dihydro-2H-benzo[d]imidazol-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methylsulfonyl-1,3-dihydrobenzimidazol-2-one (CAS 1075753-24-0) is a chemical compound with the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. IUPAC name: 5-methylsulfonyl-1,3-dihydrobenzimidazol-2-one. InChIKey: ABQZOLIIOMZLLT-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3S |
|---|---|
| Molecular weight | 212.23 g/mol |
| IUPAC name | 5-methylsulfonyl-1,3-dihydrobenzimidazol-2-one |
| InChIKey | ABQZOLIIOMZLLT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)NC(=O)N2 |
Computed by PubChem (NCBI)