Products 107766-37-0
CAS 107766-37-0 is the registry number for Trimethylammonium chloride-d10, 98.0%. Offered by: MedChemExpress. Available pack sizes: 500 mg, 250 mg, 100 mg.
(2H)chlorane;1,1,1-trideuterio-N,N-bis(trideuteriomethyl)methanamine (CAS 107766-37-0) is a chemical compound with the molecular formula C3H10ClN and a molecular weight of 105.63 g/mol. IUPAC name: (2H)chlorane;1,1,1-trideuterio-N,N-bis(trideuteriomethyl)methanamine. InChIKey: SZYJELPVAFJOGJ-HMROAWRFSA-N.
| Molecular formula | C3H10ClN |
|---|---|
| Molecular weight | 105.63 g/mol |
| IUPAC name | (2H)chlorane;1,1,1-trideuterio-N,N-bis(trideuteriomethyl)methanamine |
| InChIKey | SZYJELPVAFJOGJ-HMROAWRFSA-N |
| SMILES | [2H]C([2H])([2H])N(C([2H])([2H])[2H])C([2H])([2H])[2H].[2H]Cl |
Computed by PubChem (NCBI)