Products 107841-64-5
CAS 107841-64-5 appears in our catalog under these names: Rel-(1R,2R)-2-phenylcyclobutane-1-carboxylic acid, 97%, trans-2-phenylcyclobutane-1-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Trans-(1R,2R)-2-phenylcyclobutane-1-carboxylic acid (CAS 107841-64-5) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: trans-(1R,2R)-2-phenylcyclobutane-1-carboxylic acid. InChIKey: NYTUABLWSVGNGV-VHSXEESVSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | trans-(1R,2R)-2-phenylcyclobutane-1-carboxylic acid |
| InChIKey | NYTUABLWSVGNGV-VHSXEESVSA-N |
| SMILES | C1C[C@H]([C@@H]1C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
trans-2-phenylcyclobutane-1-carboxylic acid, (1R,2R)-2-phenylcyclobutane-1-carboxylic acid, (1R,2R)-2-Phenylcyclobutanecarboxylic acid, trans-2-Phenylcyclobutanecarboxylic Acid, starbld0027843, rel-(1R,2R)-2-Phenylcyclobutanecarboxylic acid, Rel-(1R,2R)-2-phenylcyclobutane-1-carboxylic acid, Cyclobutanecarboxylic acid, 2-phenyl-, (1R,2R)-rel-