Products 91142-54-0
CAS 91142-54-0 appears in our catalog under these names: 2-Phenylcyclobutane-1-carboxylic acid, 95%, 2-Phenylcyclobutane-1-carboxylic acid, 97%, 2-Phenylcyclobutane-1-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 50mg, 0,5g.
2-phenylcyclobutane-1-carboxylic acid (CAS 91142-54-0) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 2-phenylcyclobutane-1-carboxylic acid. InChIKey: NYTUABLWSVGNGV-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2-phenylcyclobutane-1-carboxylic acid |
| InChIKey | NYTUABLWSVGNGV-UHFFFAOYSA-N |
| SMILES | C1CC(C1C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)