CAS 107855-60-7 appears in our catalog under these names: 1,3-Dimethyl 2-(3-chlorophenyl)propanedioate, 95%, 1,3-Dimethyl 2-(3-chlorophenyl)propanedioate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Dimethyl 2-(3-chlorophenyl)propanedioate (CAS 107855-60-7) is a chemical compound with the molecular formula C11H11ClO4 and a molecular weight of 242.65 g/mol. IUPAC name: dimethyl 2-(3-chlorophenyl)propanedioate. InChIKey: VROUULBTDDNVNY-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4 |
|---|---|
| Molecular weight | 242.65 g/mol |
| IUPAC name | dimethyl 2-(3-chlorophenyl)propanedioate |
| InChIKey | VROUULBTDDNVNY-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=CC=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)