Products 107917-50-0
CAS 107917-50-0 appears in our catalog under these names: 6-Oxo-5,6-dihydrophenanthridine-2-carboxylic acid, 95%, 95%, 6-Oxo-5,6-dihydrophenanthridine-2-carboxylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
6-oxo-5H-phenanthridine-2-carboxylic acid (CAS 107917-50-0) is a chemical compound with the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. IUPAC name: 6-oxo-5H-phenanthridine-2-carboxylic acid. InChIKey: UQJFJMGMOGWAFO-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 6-oxo-5H-phenanthridine-2-carboxylic acid |
| InChIKey | UQJFJMGMOGWAFO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC(=C3)C(=O)O)NC2=O |
Computed by PubChem (NCBI)