Products 108009-46-7
CAS 108009-46-7 appears in our catalog under these names: 1,3-Diphenyl-d10-urea, >95% (HPLC), 1,3-Diphenyl-d10-urea, 99 atom % D, min 98% Chemical Purity, 1,3-Diphenylurea-d10, 99%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 0,1g, 0,05g, 10 mg, 5 mg, 1 mg.
1,3-bis(2,3,4,5,6-pentadeuteriophenyl)urea (CAS 108009-46-7) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 222.31 g/mol. IUPAC name: 1,3-bis(2,3,4,5,6-pentadeuteriophenyl)urea. InChIKey: GWEHVDNNLFDJLR-LHNTUAQVSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 222.31 g/mol |
| IUPAC name | 1,3-bis(2,3,4,5,6-pentadeuteriophenyl)urea |
| InChIKey | GWEHVDNNLFDJLR-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC(=O)NC2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)