Products 1080622-72-5
CAS 1080622-72-5 is the registry number for 2,4-Dichloro-6-(4-methylpiperazin-1-yl)pyrimidine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4-dichloro-6-(4-methylpiperazin-1-yl)pyrimidine (CAS 1080622-72-5) is a chemical compound with the molecular formula C9H12Cl2N4 and a molecular weight of 247.12 g/mol. IUPAC name: 2,4-dichloro-6-(4-methylpiperazin-1-yl)pyrimidine. InChIKey: WMLOWDFRQIVNAB-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N4 |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | 2,4-dichloro-6-(4-methylpiperazin-1-yl)pyrimidine |
| InChIKey | WMLOWDFRQIVNAB-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)