CAS 1337882-06-0 is the registry number for [(5-Phenyl-4h-1,2,4-triazol-3-yl)methyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;dihydrochloride (CAS 1337882-06-0) is a chemical compound with the molecular formula C9H12Cl2N4 and a molecular weight of 247.12 g/mol. IUPAC name: (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;dihydrochloride. InChIKey: YMUFDHMCWIQFJN-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N4 |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;dihydrochloride |
| InChIKey | YMUFDHMCWIQFJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)