CAS 1221724-87-3 appears in our catalog under these names: [4-(1H-1,2,4-Triazol-1-yl)phenyl]methanamine dihydrochloride, 95%, (4-(1H-1,2,4-Triazol-1-yl)phenyl)methanamine dihydrochloride, 98%, (4-(1H-1,2,4-Triazol-1-yl)phenyl)methanamine dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 0,5g.
[4-(1,2,4-triazol-1-yl)phenyl]methanamine;dihydrochloride (CAS 1221724-87-3) is a chemical compound with the molecular formula C9H12Cl2N4 and a molecular weight of 247.12 g/mol. IUPAC name: [4-(1,2,4-triazol-1-yl)phenyl]methanamine;dihydrochloride. InChIKey: CKEAXIYHWMRTGJ-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N4 |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | [4-(1,2,4-triazol-1-yl)phenyl]methanamine;dihydrochloride |
| InChIKey | CKEAXIYHWMRTGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)N2C=NC=N2.Cl.Cl |
Computed by PubChem (NCBI)