CAS 2138157-46-5 appears in our catalog under these names: (3-(4H-1,2,4-Triazol-3-yl)phenyl)methanamine hydrochloride, 95%, (3-(1H-1,2,4-Triazol-3-yl)phenyl)methanamine dihydrochloride, [3-(1H-1,2,4-triazol-3-yl)phenyl]methanamine dihydrochloride, 95%, 95%. Offered by: Chemat Brand, Biosynth, Chemat, Fluorochem. Available pack sizes: on request, 1g, 100mg, 250mg.
[3-(1H-1,2,4-triazol-5-yl)phenyl]methanamine;dihydrochloride (CAS 2138157-46-5) is a chemical compound with the molecular formula C9H12Cl2N4 and a molecular weight of 247.12 g/mol. IUPAC name: [3-(1H-1,2,4-triazol-5-yl)phenyl]methanamine;dihydrochloride. InChIKey: VETFKEXVPYZFQE-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N4 |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | [3-(1H-1,2,4-triazol-5-yl)phenyl]methanamine;dihydrochloride |
| InChIKey | VETFKEXVPYZFQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC=NN2)CN.Cl.Cl |
Computed by PubChem (NCBI)