CAS 1803593-74-9 is the registry number for (5-(1H-Pyrazol-1-yl)pyridin-2-yl)methanamine dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(5-pyrazol-1-yl-2-pyridinyl)methanamine;dihydrochloride (CAS 1803593-74-9) is a chemical compound with the molecular formula C9H12Cl2N4 and a molecular weight of 247.12 g/mol. IUPAC name: (5-pyrazol-1-yl-2-pyridinyl)methanamine;dihydrochloride. InChIKey: JSYOWJYXYLSRJN-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N4 |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | (5-pyrazol-1-yl-2-pyridinyl)methanamine;dihydrochloride |
| InChIKey | JSYOWJYXYLSRJN-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CN=C(C=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)