CAS 2219368-62-2 is the registry number for (4-(1H-1,2,4-Triazol-3-yl)phenyl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[4-(1H-1,2,4-triazol-5-yl)phenyl]methanamine;dihydrochloride (CAS 2219368-62-2) is a chemical compound with the molecular formula C9H12Cl2N4 and a molecular weight of 247.12 g/mol. IUPAC name: [4-(1H-1,2,4-triazol-5-yl)phenyl]methanamine;dihydrochloride. InChIKey: GAVWCDCNVUKQHO-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N4 |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | [4-(1H-1,2,4-triazol-5-yl)phenyl]methanamine;dihydrochloride |
| InChIKey | GAVWCDCNVUKQHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C2=NC=NN2.Cl.Cl |
Computed by PubChem (NCBI)