Products 2243515-88-8

CAS 2243515-88-8 is the registry number for 4-(4-Methyl-4h-1,2,4-triazol-3-yl)aniline dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

4-(4-methyl-1,2,4-triazol-3-yl)aniline;dihydrochloride (CAS 2243515-88-8) is a chemical compound with the molecular formula C9H12Cl2N4 and a molecular weight of 247.12 g/mol. IUPAC name: 4-(4-methyl-1,2,4-triazol-3-yl)aniline;dihydrochloride. InChIKey: PRVPMOQDOBVFIS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12Cl2N4
Molecular weight247.12 g/mol
IUPAC name4-(4-methyl-1,2,4-triazol-3-yl)aniline;dihydrochloride
InChIKeyPRVPMOQDOBVFIS-UHFFFAOYSA-N
SMILESCN1C=NN=C1C2=CC=C(C=C2)N.Cl.Cl

Computed by PubChem (NCBI)