CAS 2243515-88-8 is the registry number for 4-(4-Methyl-4h-1,2,4-triazol-3-yl)aniline dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
4-(4-methyl-1,2,4-triazol-3-yl)aniline;dihydrochloride (CAS 2243515-88-8) is a chemical compound with the molecular formula C9H12Cl2N4 and a molecular weight of 247.12 g/mol. IUPAC name: 4-(4-methyl-1,2,4-triazol-3-yl)aniline;dihydrochloride. InChIKey: PRVPMOQDOBVFIS-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N4 |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | 4-(4-methyl-1,2,4-triazol-3-yl)aniline;dihydrochloride |
| InChIKey | PRVPMOQDOBVFIS-UHFFFAOYSA-N |
| SMILES | CN1C=NN=C1C2=CC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)