Products 1081816-56-9
CAS 1081816-56-9 is the registry number for 2-bromo-1,3-dichloro-4-nitrobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-bromo-1,3-dichloro-4-nitrobenzene (CAS 1081816-56-9) is a chemical compound with the molecular formula C6H2BrCl2NO2 and a molecular weight of 270.89 g/mol. IUPAC name: 2-bromo-1,3-dichloro-4-nitrobenzene. InChIKey: GCZNRAYEBNRGKX-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2NO2 |
|---|---|
| Molecular weight | 270.89 g/mol |
| IUPAC name | 2-bromo-1,3-dichloro-4-nitrobenzene |
| InChIKey | GCZNRAYEBNRGKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])Cl)Br)Cl |
Computed by PubChem (NCBI)