CAS 1081834-96-9 is the registry number for 2-Amino-n,n-dimethylbenzamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-amino-N,N-dimethylbenzamide;hydrochloride (CAS 1081834-96-9) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: 2-amino-N,N-dimethylbenzamide;hydrochloride. InChIKey: BGDPTOJYZYZLPQ-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | 2-amino-N,N-dimethylbenzamide;hydrochloride |
| InChIKey | BGDPTOJYZYZLPQ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=CC=C1N.Cl |
Computed by PubChem (NCBI)