CAS 160842-62-6 appears in our catalog under these names: 3-(tert-Butyl)-1-methyl-1H-pyrazole-5-carbonyl chloride, 98%, 3-(tert-Butyl)-1-methylpyrazole-5-carbonylchloride, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g, 10g, 250mg.
3-tert-butyl-1-methylpyrazole-5-carbonyl chloride (CAS 160842-62-6) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: 3-tert-butyl-1-methylpyrazole-5-carbonyl chloride. InChIKey: SJGURXGUNLVMAQ-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | 3-tert-butyl-1-methylpyrazole-5-carbonyl chloride |
| InChIKey | SJGURXGUNLVMAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)C(=O)Cl)C |
Computed by PubChem (NCBI)