Products 1082041-83-5
CAS 1082041-83-5 appears in our catalog under these names: 4,6-Dichloroindolin-2-one, 95%, 4，6-Dichloro-2H-indol-2-one. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g.
4,6-dichloroindol-2-one (CAS 1082041-83-5) is a chemical compound with the molecular formula C8H3Cl2NO and a molecular weight of 200.02 g/mol. IUPAC name: 4,6-dichloroindol-2-one. InChIKey: DFKJBFZROQHSQY-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 4,6-dichloroindol-2-one |
| InChIKey | DFKJBFZROQHSQY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=CC(=O)N=C21)Cl)Cl |
Computed by PubChem (NCBI)