CAS 64985-85-9 is the registry number for 2,5-Dichlorobenzoyl Cyanide. Offered by: TRC, Mikromol. Available pack sizes: 5g, 25mg.
2,5-dichlorobenzoyl cyanide (CAS 64985-85-9) is a chemical compound with the molecular formula C8H3Cl2NO and a molecular weight of 200.02 g/mol. IUPAC name: 2,5-dichlorobenzoyl cyanide. InChIKey: OCMOGGGMWSRSAG-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 2,5-dichlorobenzoyl cyanide |
| InChIKey | OCMOGGGMWSRSAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)C#N)Cl |
Computed by PubChem (NCBI)