CAS 77668-42-9 appears in our catalog under these names: Lamotrigine Impurity 2, Lamotrigine Impurity 5, 2,3-Dichlorobenzoyl Nitrile, >95% (HPLC), 2-(2,3-Dichlorophenyl)-2-oxoacetonitrile (2,3-Dichlorobenzoylcyanide), 2,3-Dichlorobenzoyl cyanide, 95%. Offered by: Chemat Brand, TRC, Mikromol, Fluorochem, Ambeed. Available pack sizes: on request, 10g, 1g, 25mg, 5g, 25g, 100g.
2,3-dichlorobenzoyl cyanide (CAS 77668-42-9) is a chemical compound with the molecular formula C8H3Cl2NO and a molecular weight of 200.02 g/mol. IUPAC name: 2,3-dichlorobenzoyl cyanide. InChIKey: FIBBFBXFASKAON-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 2,3-dichlorobenzoyl cyanide |
| InChIKey | FIBBFBXFASKAON-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=O)C#N |
Computed by PubChem (NCBI)