Products 99567-74-5

CAS 99567-74-5 is the registry number for 3,5-Dichlorobenzoyl Cyanide. Offered by: Mikromol, Biosynth. Available pack sizes: 25mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

3,5-dichlorobenzoyl cyanide (CAS 99567-74-5) is a chemical compound with the molecular formula C8H3Cl2NO and a molecular weight of 200.02 g/mol. IUPAC name: 3,5-dichlorobenzoyl cyanide. InChIKey: HQMFFHQHAQDOHZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3Cl2NO
Molecular weight200.02 g/mol
IUPAC name3,5-dichlorobenzoyl cyanide
InChIKeyHQMFFHQHAQDOHZ-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1Cl)Cl)C(=O)C#N

Computed by PubChem (NCBI)