CAS 99567-74-5 is the registry number for 3,5-Dichlorobenzoyl Cyanide. Offered by: Mikromol, Biosynth. Available pack sizes: 25mg, 100mg, 1g.
3,5-dichlorobenzoyl cyanide (CAS 99567-74-5) is a chemical compound with the molecular formula C8H3Cl2NO and a molecular weight of 200.02 g/mol. IUPAC name: 3,5-dichlorobenzoyl cyanide. InChIKey: HQMFFHQHAQDOHZ-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 3,5-dichlorobenzoyl cyanide |
| InChIKey | HQMFFHQHAQDOHZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(=O)C#N |
Computed by PubChem (NCBI)