Products 2145093-86-1
CAS 2145093-86-1 appears in our catalog under these names: 3-Cyano-2,4-dichlorobenzaldehyde, 95%, 2,6-Dichloro-3-formylbenzonitrile, 97%, 2,6-Dichloro-3-formylbenzonitrile, 98%, 3-Cyano-2,4-dichlorobenzaldehyde, ≥95%, ≥95%, 3-Cyano-2,4-dichlorobenzaldehyde. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 250mg.
2,6-dichloro-3-formylbenzonitrile (CAS 2145093-86-1) is a chemical compound with the molecular formula C8H3Cl2NO and a molecular weight of 200.02 g/mol. IUPAC name: 2,6-dichloro-3-formylbenzonitrile. InChIKey: SVANCYRXLQJAOM-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 2,6-dichloro-3-formylbenzonitrile |
| InChIKey | SVANCYRXLQJAOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)Cl)C#N)Cl |
Computed by PubChem (NCBI)