Products 122483-59-4
CAS 122483-59-4 is the registry number for 2-Chloro-5-cyanobenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g, 5g.
2-chloro-5-cyanobenzoyl chloride (CAS 122483-59-4) is a chemical compound with the molecular formula C8H3Cl2NO and a molecular weight of 200.02 g/mol. IUPAC name: 2-chloro-5-cyanobenzoyl chloride. InChIKey: NSYWZVSVGZQXSF-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 2-chloro-5-cyanobenzoyl chloride |
| InChIKey | NSYWZVSVGZQXSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)C(=O)Cl)Cl |
Computed by PubChem (NCBI)