Products 88562-25-8
CAS 88562-25-8 is the registry number for Lamotrigine Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dichlorobenzoyl cyanide (CAS 88562-25-8) is a chemical compound with the molecular formula C8H3Cl2NO and a molecular weight of 200.02 g/mol. IUPAC name: 2,6-dichlorobenzoyl cyanide. InChIKey: VCXSOMQTJPUNCU-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 2,6-dichlorobenzoyl cyanide |
| InChIKey | VCXSOMQTJPUNCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)C#N)Cl |
Computed by PubChem (NCBI)