CAS 1087723-62-3 appears in our catalog under these names: 2-Thien-2-ylaniline hydrochloride, 95%, 2-(Thien-2-yl)aniline hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 10g, 1g, 5g, 2,5g.
2-thiophen-2-ylaniline;hydrochloride (CAS 1087723-62-3) is a chemical compound with the molecular formula C10H10ClNS and a molecular weight of 211.71 g/mol. IUPAC name: 2-thiophen-2-ylaniline;hydrochloride. InChIKey: WDJVKCOXPQGNOZ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNS |
|---|---|
| Molecular weight | 211.71 g/mol |
| IUPAC name | 2-thiophen-2-ylaniline;hydrochloride |
| InChIKey | WDJVKCOXPQGNOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CS2)N.Cl |
Computed by PubChem (NCBI)